C3H15N7O8P2 — CID 173308958
azane;phosphoric acid;1,3,5-triazine-2,4,6-triamine (PubChem CID 173308958) has the molecular formula C3H15N7O8P2 and a molecular weight of 339.14 g/mol. Its IUPAC name is azane;phosphoric acid;1,3,5-triazine-2,4,6-triamine.
| Compound Name | azane;phosphoric acid;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 173308958 |
| Molecular Formula | C3H15N7O8P2 |
| Molecular Weight | 339.14 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | azane;phosphoric acid;1,3,5-triazine-2,4,6-triamine |
| SMILES | N.Nc1nc(N)nc(N)n1.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C3H6N6.H3N.2H3O4P/c4-1-7-2(5)9-3(6)8-1;;2*1-5(2,3)4/h(H6,4,5,6,7,8,9);1H3;2*(H3,1,2,3,4) |
| InChIKey | PUQDBVDJQWGPIO-UHFFFAOYSA-N |
| XLogP | -3.08 |
| TPSA | 307.25 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.14 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|