C3H9CoN7 — CID 172711382
azane;cobalt;1,3,5-triazine-2,4,6-triamine (PubChem CID 172711382) has the molecular formula C3H9CoN7 and a molecular weight of 202.09 g/mol. Its IUPAC name is azane;cobalt;1,3,5-triazine-2,4,6-triamine.
| Compound Name | azane;cobalt;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 172711382 |
| Molecular Formula | C3H9CoN7 |
| Molecular Weight | 202.09 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | azane;cobalt;1,3,5-triazine-2,4,6-triamine |
| SMILES | N.Nc1nc(N)nc(N)n1.[Co] |
| InChI | InChI=1S/C3H6N6.Co.H3N/c4-1-7-2(5)9-3(6)8-1;;/h(H6,4,5,6,7,8,9);;1H3 |
| InChIKey | BGWBJSQJUVIELM-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.09 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |