C3H6CeN6 — CID 161330303
cerium;1,3,5-triazine-2,4,6-triamine (PubChem CID 161330303) has the molecular formula C3H6CeN6 and a molecular weight of 266.24 g/mol. Its IUPAC name is cerium;1,3,5-triazine-2,4,6-triamine.
| Compound Name | cerium;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 161330303 |
| Molecular Formula | C3H6CeN6 |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | cerium;1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(N)nc(N)n1.[Ce] |
| InChI | InChI=1S/C3H6N6.Ce/c4-1-7-2(5)9-3(6)8-1;/h(H6,4,5,6,7,8,9); |
| InChIKey | VLIDOCYQVBYBNR-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |