About CID 161237942
CID 161237942 (PubChem CID 161237942) has the molecular formula C3H6MgN6OS
and a molecular weight of 198.49 g/mol.
Molecular Properties
| Compound Name | CID 161237942 |
| PubChem CID | 161237942 |
| Molecular Formula | C3H6MgN6OS |
| Molecular Weight | 198.49 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | — |
| SMILES | Nc1nc(N)nc(N)n1.O=S.[Mg] |
| InChI | InChI=1S/C3H6N6.Mg.OS/c4-1-7-2(5)9-3(6)8-1;;1-2/h(H6,4,5,6,7,8,9);; |
| InChIKey | WRUIXNRVNIMBDS-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.49 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 161237942 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161237942?
The IUPAC name of CID 161237942 (CID 161237942) is not available.
What is the SMILES notation for CID 161237942?
The canonical SMILES for CID 161237942 is Nc1nc(N)nc(N)n1.O=S.[Mg].
What is the InChIKey of CID 161237942?
The InChIKey is WRUIXNRVNIMBDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N6.Mg.OS/c4-1-7-2(5)9-3(6)8-1;;1-2/h(H6,4,5,6,7,8,9);;.
What are the key properties of CID 161237942?
CID 161237942 has a molecular weight of 198.49 g/mol, XLogP of -2.10, 0 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161237942 is sourced from PubChem (CID 161237942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).