C16H16N8 — CID 71395305
2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-1-phenylguanidine (PubChem CID 71395305) has the molecular formula C16H16N8 and a molecular weight of 320.36 g/mol. Its IUPAC name is 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-1-phenylguanidine.
| Compound Name | 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-1-phenylguanidine |
|---|---|
| PubChem CID | 71395305 |
| Molecular Formula | C16H16N8 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-1-phenylguanidine |
| SMILES | NC(=Nc1nc(N)nc(Nc2ccccc2)n1)Nc1ccccc1 |
| InChI | InChI=1S/C16H16N8/c17-13(19-11-7-3-1-4-8-11)21-16-23-14(18)22-15(24-16)20-12-9-5-2-6-10-12/h1-10H,(H6,17,18,19,20,21,22,23,24) |
| InChIKey | MCOGFJYXCMNAQN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 127.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|