C10H10N6O — CID 46705553
5-nitroso-2-N-phenylpyrimidine-2,4,6-triamine (PubChem CID 46705553) has the molecular formula C10H10N6O and a molecular weight of 230.23 g/mol. Its IUPAC name is 5-nitroso-2-N-phenylpyrimidine-2,4,6-triamine.
| Compound Name | 5-nitroso-2-N-phenylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 46705553 |
| Molecular Formula | C10H10N6O |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 5-nitroso-2-N-phenylpyrimidine-2,4,6-triamine |
| SMILES | Nc1nc(Nc2ccccc2)nc(N)c1N=O |
| InChI | InChI=1S/C10H10N6O/c11-8-7(16-17)9(12)15-10(14-8)13-6-4-2-1-3-5-6/h1-5H,(H5,11,12,13,14,15) |
| InChIKey | JNCGEKHALITTKD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |