C8H9ClN4S — CID 51062515
3-N-phenyl-1,2,4-thiadiazole-3,5-diamine;hydrochloride (PubChem CID 51062515) has the molecular formula C8H9ClN4S and a molecular weight of 228.71 g/mol. Its IUPAC name is 3-N-phenyl-1,2,4-thiadiazole-3,5-diamine;hydrochloride.
| Compound Name | 3-N-phenyl-1,2,4-thiadiazole-3,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 51062515 |
| Molecular Formula | C8H9ClN4S |
| Molecular Weight | 228.71 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 3-N-phenyl-1,2,4-thiadiazole-3,5-diamine;hydrochloride |
| SMILES | Cl.Nc1nc(Nc2ccccc2)ns1 |
| InChI | InChI=1S/C8H8N4S.ClH/c9-7-11-8(12-13-7)10-6-4-2-1-3-5-6;/h1-5H,(H3,9,10,11,12);1H |
| InChIKey | KQMCINMUISRUAT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.71 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |