C11H13N5 — CID 175235509
5-N-methyl-2-N-phenylpyrimidine-2,4,5-triamine (PubChem CID 175235509) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 5-N-methyl-2-N-phenylpyrimidine-2,4,5-triamine.
| Compound Name | 5-N-methyl-2-N-phenylpyrimidine-2,4,5-triamine |
|---|---|
| PubChem CID | 175235509 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 5-N-methyl-2-N-phenylpyrimidine-2,4,5-triamine |
| SMILES | CNc1cnc(Nc2ccccc2)nc1N |
| InChI | InChI=1S/C11H13N5/c1-13-9-7-14-11(16-10(9)12)15-8-5-3-2-4-6-8/h2-7,13H,1H3,(H3,12,14,15,16) |
| InChIKey | PPOVRBKBPAUBIK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |