C19H21N5O — CID 143150930
5-(benzenecarboximidoyl)-2-N-phenylpyrimidine-2,4-diamine;methoxymethane (PubChem CID 143150930) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 5-(benzenecarboximidoyl)-2-N-phenylpyrimidine-2,4-diamine;methoxymethane.
| Compound Name | 5-(benzenecarboximidoyl)-2-N-phenylpyrimidine-2,4-diamine;methoxymethane |
|---|---|
| PubChem CID | 143150930 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 5-(benzenecarboximidoyl)-2-N-phenylpyrimidine-2,4-diamine;methoxymethane |
| SMILES | COC.[H]/N=C(\c1ccccc1)c1cnc(Nc2ccccc2)nc1N |
| InChI | InChI=1S/C17H15N5.C2H6O/c18-15(12-7-3-1-4-8-12)14-11-20-17(22-16(14)19)21-13-9-5-2-6-10-13;1-3-2/h1-11,18H,(H3,19,20,21,22);1-2H3/b18-15+; |
| InChIKey | CMKZDSJCOYRIIC-FLNCGGNMSA-N |
| XLogP | 3.48 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|