C20H21N5 — CID 144944099
5-(benzenecarboximidoyl)-2-N-phenyl-4-N-propan-2-ylpyrimidine-2,4-diamine (PubChem CID 144944099) has the molecular formula C20H21N5 and a molecular weight of 331.42 g/mol. Its IUPAC name is 5-(benzenecarboximidoyl)-2-N-phenyl-4-N-propan-2-ylpyrimidine-2,4-diamine.
| Compound Name | 5-(benzenecarboximidoyl)-2-N-phenyl-4-N-propan-2-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 144944099 |
| Molecular Formula | C20H21N5 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 5-(benzenecarboximidoyl)-2-N-phenyl-4-N-propan-2-ylpyrimidine-2,4-diamine |
| SMILES | [H]/N=C(\c1ccccc1)c1cnc(Nc2ccccc2)nc1NC(C)C |
| InChI | InChI=1S/C20H21N5/c1-14(2)23-19-17(18(21)15-9-5-3-6-10-15)13-22-20(25-19)24-16-11-7-4-8-12-16/h3-14,21H,1-2H3,(H2,22,23,24,25)/b21-18+ |
| InChIKey | ZERYUPAGQGLDIP-DYTRJAOYSA-N |
| XLogP | 4.46 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|