C21H25BrN6 — CID 10275057
5-bromo-4-N-phenyl-2-N-[4-[2-(propan-2-ylamino)ethylamino]phenyl]pyrimidine-2,4-diamine (PubChem CID 10275057) has the molecular formula C21H25BrN6 and a molecular weight of 441.38 g/mol. Its IUPAC name is 5-bromo-4-N-phenyl-2-N-[4-[2-(propan-2-ylamino)ethylamino]phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-4-N-phenyl-2-N-[4-[2-(propan-2-ylamino)ethylamino]phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 10275057 |
| Molecular Formula | C21H25BrN6 |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 5-bromo-4-N-phenyl-2-N-[4-[2-(propan-2-ylamino)ethylamino]phenyl]pyrimidine-2,4-diamine |
| SMILES | CC(C)NCCNc1ccc(Nc2ncc(Br)c(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C21H25BrN6/c1-15(2)23-12-13-24-16-8-10-18(11-9-16)27-21-25-14-19(22)20(28-21)26-17-6-4-3-5-7-17/h3-11,14-15,23-24H,12-13H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | VGDBUSCPHQFLTB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 73.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|