C12H14BrN5O — CID 143697332
2-[[2-(4-aminoanilino)-5-bromopyrimidin-4-yl]amino]ethanol (PubChem CID 143697332) has the molecular formula C12H14BrN5O and a molecular weight of 324.18 g/mol. Its IUPAC name is 2-[[2-(4-aminoanilino)-5-bromopyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-[[2-(4-aminoanilino)-5-bromopyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 143697332 |
| Molecular Formula | C12H14BrN5O |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 2-[[2-(4-aminoanilino)-5-bromopyrimidin-4-yl]amino]ethanol |
| SMILES | Nc1ccc(Nc2ncc(Br)c(NCCO)n2)cc1 |
| InChI | InChI=1S/C12H14BrN5O/c13-10-7-16-12(18-11(10)15-5-6-19)17-9-3-1-8(14)2-4-9/h1-4,7,19H,5-6,14H2,(H2,15,16,17,18) |
| InChIKey | WEXWRCQOTCUAGI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|