C12H12BFN4O3S — CID 163850248
CID 163850248 (PubChem CID 163850248) has the molecular formula C12H12BFN4O3S and a molecular weight of 322.13 g/mol.
| Compound Name | CID 163850248 |
|---|---|
| PubChem CID | 163850248 |
| Molecular Formula | C12H12BFN4O3S |
| Molecular Weight | 322.13 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Nc2ccc(S(=O)(=O)F)cc2)nc1NCCO |
| InChI | InChI=1S/C12H12BFN4O3S/c13-10-7-16-12(18-11(10)15-5-6-19)17-8-1-3-9(4-2-8)22(14,20)21/h1-4,7,19H,5-6H2,(H2,15,16,17,18) |
| InChIKey | ILVNCDVKOKNXAX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.13 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|