C11H8FN5O2S — CID 22393274
4-[(4-amino-5-cyanopyrimidin-2-yl)amino]benzenesulfonyl fluoride (PubChem CID 22393274) has the molecular formula C11H8FN5O2S and a molecular weight of 293.28 g/mol. Its IUPAC name is 4-[(4-amino-5-cyanopyrimidin-2-yl)amino]benzenesulfonyl fluoride.
| Compound Name | 4-[(4-amino-5-cyanopyrimidin-2-yl)amino]benzenesulfonyl fluoride |
|---|---|
| PubChem CID | 22393274 |
| Molecular Formula | C11H8FN5O2S |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 4-[(4-amino-5-cyanopyrimidin-2-yl)amino]benzenesulfonyl fluoride |
| SMILES | N#Cc1cnc(Nc2ccc(S(=O)(=O)F)cc2)nc1N |
| InChI | InChI=1S/C11H8FN5O2S/c12-20(18,19)9-3-1-8(2-4-9)16-11-15-6-7(5-13)10(14)17-11/h1-4,6H,(H3,14,15,16,17) |
| InChIKey | BEMPUVYZJSHCLL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |