C16H14ClN5 — CID 134527293
4-[[4-amino-5-(5-chloropent-1-ynyl)pyrimidin-2-yl]amino]benzonitrile (PubChem CID 134527293) has the molecular formula C16H14ClN5 and a molecular weight of 311.78 g/mol. Its IUPAC name is 4-[[4-amino-5-(5-chloropent-1-ynyl)pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-amino-5-(5-chloropent-1-ynyl)pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 134527293 |
| Molecular Formula | C16H14ClN5 |
| Molecular Weight | 311.78 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-[[4-amino-5-(5-chloropent-1-ynyl)pyrimidin-2-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2ncc(C#CCCCCl)c(N)n2)cc1 |
| InChI | InChI=1S/C16H14ClN5/c17-9-3-1-2-4-13-11-20-16(22-15(13)19)21-14-7-5-12(10-18)6-8-14/h5-8,11H,1,3,9H2,(H3,19,20,21,22) |
| InChIKey | GAIFMALUDLKKJQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.78 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|