C26H27N7O — CID 145232326
(2S)-N-[5-[4-anilino-2-(4-cyanoanilino)pyrimidin-5-yl]pent-4-ynyl]-2-(methylamino)propanamide (PubChem CID 145232326) has the molecular formula C26H27N7O and a molecular weight of 453.55 g/mol. Its IUPAC name is (2S)-N-[5-[4-anilino-2-(4-cyanoanilino)pyrimidin-5-yl]pent-4-ynyl]-2-(methylamino)propanamide.
| Compound Name | (2S)-N-[5-[4-anilino-2-(4-cyanoanilino)pyrimidin-5-yl]pent-4-ynyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 145232326 |
| Molecular Formula | C26H27N7O |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | (2S)-N-[5-[4-anilino-2-(4-cyanoanilino)pyrimidin-5-yl]pent-4-ynyl]-2-(methylamino)propanamide |
| SMILES | CN[C@@H](C)C(=O)NCCCC#Cc1cnc(Nc2ccc(C#N)cc2)nc1Nc1ccccc1 |
| InChI | InChI=1S/C26H27N7O/c1-19(28-2)25(34)29-16-8-4-5-9-21-18-30-26(32-23-14-12-20(17-27)13-15-23)33-24(21)31-22-10-6-3-7-11-22/h3,6-7,10-15,18-19,28H,4,8,16H2,1-2H3,(H,29,34)(H2,30,31,32,33)/t19-/m0/s1 |
| InChIKey | FPOKLGMOPBJBLE-IBGZPJMESA-N |
| XLogP | 3.69 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|