C19H28N8OS — CID 90052936
(2S)-2-(methylamino)-N-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]propanamide (PubChem CID 90052936) has the molecular formula C19H28N8OS and a molecular weight of 416.56 g/mol. Its IUPAC name is (2S)-2-(methylamino)-N-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]propanamide.
| Compound Name | (2S)-2-(methylamino)-N-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]propanamide |
|---|---|
| PubChem CID | 90052936 |
| Molecular Formula | C19H28N8OS |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (2S)-2-(methylamino)-N-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynyl]propanamide |
| SMILES | CCCNc1nc(Nc2nnc(C)s2)ncc1C#CCCCNC(=O)[C@H](C)NC |
| InChI | InChI=1S/C19H28N8OS/c1-5-10-21-16-15(9-7-6-8-11-22-17(28)13(2)20-4)12-23-18(24-16)25-19-27-26-14(3)29-19/h12-13,20H,5-6,8,10-11H2,1-4H3,(H,22,28)(H2,21,23,24,25,27)/t13-/m0/s1 |
| InChIKey | DTEHYHXGTUMZIX-ZDUSSCGKSA-N |
| XLogP | 2.06 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|