C25H37N9O2S — CID 90053448
(E)-4-(dimethylamino)-N-methyl-N-[(2S)-1-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]but-2-enamide (PubChem CID 90053448) has the molecular formula C25H37N9O2S and a molecular weight of 527.70 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-methyl-N-[(2S)-1-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]but-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-methyl-N-[(2S)-1-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]but-2-enamide |
|---|---|
| PubChem CID | 90053448 |
| Molecular Formula | C25H37N9O2S |
| Molecular Weight | 527.70 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | (E)-4-(dimethylamino)-N-methyl-N-[(2S)-1-[5-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-1-oxopropan-2-yl]but-2-enamide |
| SMILES | CCCNc1nc(Nc2nnc(C)s2)ncc1C#CCCCNC(=O)[C@H](C)N(C)C(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C25H37N9O2S/c1-7-14-26-22-20(17-28-24(29-22)30-25-32-31-19(3)37-25)12-9-8-10-15-27-23(36)18(2)34(6)21(35)13-11-16-33(4)5/h11,13,17-18H,7-8,10,14-16H2,1-6H3,(H,27,36)(H2,26,28,29,30,32)/b13-11+/t18-/m0/s1 |
| InChIKey | PQVOBEFDNKBPIH-YLZCUGDYSA-N |
| XLogP | 2.41 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.70 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|