C24H31N7O — CID 90052897
(2S)-N-[5-[2-(4-cyanoanilino)-4-methyl-6-(propylamino)pyrimidin-5-yl]pent-4-ynyl]-2-(methylamino)propanamide (PubChem CID 90052897) has the molecular formula C24H31N7O and a molecular weight of 433.56 g/mol. Its IUPAC name is (2S)-N-[5-[2-(4-cyanoanilino)-4-methyl-6-(propylamino)pyrimidin-5-yl]pent-4-ynyl]-2-(methylamino)propanamide.
| Compound Name | (2S)-N-[5-[2-(4-cyanoanilino)-4-methyl-6-(propylamino)pyrimidin-5-yl]pent-4-ynyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 90052897 |
| Molecular Formula | C24H31N7O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | (2S)-N-[5-[2-(4-cyanoanilino)-4-methyl-6-(propylamino)pyrimidin-5-yl]pent-4-ynyl]-2-(methylamino)propanamide |
| SMILES | CCCNc1nc(Nc2ccc(C#N)cc2)nc(C)c1C#CCCCNC(=O)[C@H](C)NC |
| InChI | InChI=1S/C24H31N7O/c1-5-14-27-22-21(9-7-6-8-15-28-23(32)18(3)26-4)17(2)29-24(31-22)30-20-12-10-19(16-25)11-13-20/h10-13,18,26H,5-6,8,14-15H2,1-4H3,(H,28,32)(H2,27,29,30,31)/t18-/m0/s1 |
| InChIKey | CKOOXMPDNXLHTO-SFHVURJKSA-N |
| XLogP | 3.08 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|