C30H41N7O3 — CID 90053092
tert-butyl N-butyl-N-[2-[5-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-2-oxoethyl]carbamate (PubChem CID 90053092) has the molecular formula C30H41N7O3 and a molecular weight of 547.70 g/mol. Its IUPAC name is tert-butyl N-butyl-N-[2-[5-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-butyl-N-[2-[5-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 90053092 |
| Molecular Formula | C30H41N7O3 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.33 |
| IUPAC Name | tert-butyl N-butyl-N-[2-[5-[2-(4-cyanoanilino)-4-(propylamino)pyrimidin-5-yl]pent-4-ynylamino]-2-oxoethyl]carbamate |
| SMILES | CCCCN(CC(=O)NCCCC#Cc1cnc(Nc2ccc(C#N)cc2)nc1NCCC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H41N7O3/c1-6-8-19-37(29(39)40-30(3,4)5)22-26(38)32-18-11-9-10-12-24-21-34-28(36-27(24)33-17-7-2)35-25-15-13-23(20-31)14-16-25/h13-16,21H,6-9,11,17-19,22H2,1-5H3,(H,32,38)(H2,33,34,35,36) |
| InChIKey | VYBKEEHTQDDEMQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 132.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|