C13H12IN5 — CID 90052289
4-[[4-(ethylamino)-5-iodopyrimidin-2-yl]amino]benzonitrile (PubChem CID 90052289) has the molecular formula C13H12IN5 and a molecular weight of 365.18 g/mol. Its IUPAC name is 4-[[4-(ethylamino)-5-iodopyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-(ethylamino)-5-iodopyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 90052289 |
| Molecular Formula | C13H12IN5 |
| Molecular Weight | 365.18 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 4-[[4-(ethylamino)-5-iodopyrimidin-2-yl]amino]benzonitrile |
| SMILES | CCNc1nc(Nc2ccc(C#N)cc2)ncc1I |
| InChI | InChI=1S/C13H12IN5/c1-2-16-12-11(14)8-17-13(19-12)18-10-5-3-9(7-15)4-6-10/h3-6,8H,2H2,1H3,(H2,16,17,18,19) |
| InChIKey | QKYVGEWEPOKOIA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.18 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|