C15H16IN5 — CID 122500073
4-[[5-iodo-4-(propylamino)pyrimidin-2-yl]-methylamino]benzonitrile (PubChem CID 122500073) has the molecular formula C15H16IN5 and a molecular weight of 393.23 g/mol. Its IUPAC name is 4-[[5-iodo-4-(propylamino)pyrimidin-2-yl]-methylamino]benzonitrile.
| Compound Name | 4-[[5-iodo-4-(propylamino)pyrimidin-2-yl]-methylamino]benzonitrile |
|---|---|
| PubChem CID | 122500073 |
| Molecular Formula | C15H16IN5 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 4-[[5-iodo-4-(propylamino)pyrimidin-2-yl]-methylamino]benzonitrile |
| SMILES | CCCNc1nc(N(C)c2ccc(C#N)cc2)ncc1I |
| InChI | InChI=1S/C15H16IN5/c1-3-8-18-14-13(16)10-19-15(20-14)21(2)12-6-4-11(9-17)5-7-12/h4-7,10H,3,8H2,1-2H3,(H,18,19,20) |
| InChIKey | VCMBDHKPAVRGQS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|