C14H17N5S — CID 62981588
4-[methyl-[[5-(propylamino)thiadiazol-4-yl]methyl]amino]benzonitrile (PubChem CID 62981588) has the molecular formula C14H17N5S and a molecular weight of 287.39 g/mol. Its IUPAC name is 4-[methyl-[[5-(propylamino)thiadiazol-4-yl]methyl]amino]benzonitrile.
| Compound Name | 4-[methyl-[[5-(propylamino)thiadiazol-4-yl]methyl]amino]benzonitrile |
|---|---|
| PubChem CID | 62981588 |
| Molecular Formula | C14H17N5S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 4-[methyl-[[5-(propylamino)thiadiazol-4-yl]methyl]amino]benzonitrile |
| SMILES | CCCNc1snnc1CN(C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H17N5S/c1-3-8-16-14-13(17-18-20-14)10-19(2)12-6-4-11(9-15)5-7-12/h4-7,16H,3,8,10H2,1-2H3 |
| InChIKey | HKPMJXYCRWNHHX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |