C12H24N4S — CID 63966703
4-[[methyl(2-methylbutan-2-yl)amino]methyl]-N-propylthiadiazol-5-amine (PubChem CID 63966703) has the molecular formula C12H24N4S and a molecular weight of 256.42 g/mol. Its IUPAC name is 4-[[methyl(2-methylbutan-2-yl)amino]methyl]-N-propylthiadiazol-5-amine.
| Compound Name | 4-[[methyl(2-methylbutan-2-yl)amino]methyl]-N-propylthiadiazol-5-amine |
|---|---|
| PubChem CID | 63966703 |
| Molecular Formula | C12H24N4S |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 4-[[methyl(2-methylbutan-2-yl)amino]methyl]-N-propylthiadiazol-5-amine |
| SMILES | CCCNc1snnc1CN(C)C(C)(C)CC |
| InChI | InChI=1S/C12H24N4S/c1-6-8-13-11-10(14-15-17-11)9-16(5)12(3,4)7-2/h13H,6-9H2,1-5H3 |
| InChIKey | DEOPSJXYWOURAF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |