C12H17BrN4S2 — CID 62183351
4-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]-N-propylthiadiazol-5-amine (PubChem CID 62183351) has the molecular formula C12H17BrN4S2 and a molecular weight of 361.33 g/mol. Its IUPAC name is 4-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]-N-propylthiadiazol-5-amine.
| Compound Name | 4-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]-N-propylthiadiazol-5-amine |
|---|---|
| PubChem CID | 62183351 |
| Molecular Formula | C12H17BrN4S2 |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 4-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]-N-propylthiadiazol-5-amine |
| SMILES | CCCNc1snnc1CN(C)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C12H17BrN4S2/c1-3-4-14-12-11(15-16-19-12)7-17(2)6-10-5-9(13)8-18-10/h5,8,14H,3-4,6-7H2,1-2H3 |
| InChIKey | PRGFTMVKWGMPQM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |