C14H19ClN4S — CID 62183869
4-[[(3-chlorophenyl)methyl-methylamino]methyl]-N-propylthiadiazol-5-amine (PubChem CID 62183869) has the molecular formula C14H19ClN4S and a molecular weight of 310.85 g/mol. Its IUPAC name is 4-[[(3-chlorophenyl)methyl-methylamino]methyl]-N-propylthiadiazol-5-amine.
| Compound Name | 4-[[(3-chlorophenyl)methyl-methylamino]methyl]-N-propylthiadiazol-5-amine |
|---|---|
| PubChem CID | 62183869 |
| Molecular Formula | C14H19ClN4S |
| Molecular Weight | 310.85 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-[[(3-chlorophenyl)methyl-methylamino]methyl]-N-propylthiadiazol-5-amine |
| SMILES | CCCNc1snnc1CN(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H19ClN4S/c1-3-7-16-14-13(17-18-20-14)10-19(2)9-11-5-4-6-12(15)8-11/h4-6,8,16H,3,7,9-10H2,1-2H3 |
| InChIKey | AILNINKRLYYFLB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.85 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |