C11H21N5OS — CID 62209620
N-ethyl-2-[methyl-[[5-(propylamino)thiadiazol-4-yl]methyl]amino]acetamide (PubChem CID 62209620) has the molecular formula C11H21N5OS and a molecular weight of 271.39 g/mol. Its IUPAC name is N-ethyl-2-[methyl-[[5-(propylamino)thiadiazol-4-yl]methyl]amino]acetamide.
| Compound Name | N-ethyl-2-[methyl-[[5-(propylamino)thiadiazol-4-yl]methyl]amino]acetamide |
|---|---|
| PubChem CID | 62209620 |
| Molecular Formula | C11H21N5OS |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | N-ethyl-2-[methyl-[[5-(propylamino)thiadiazol-4-yl]methyl]amino]acetamide |
| SMILES | CCCNc1snnc1CN(C)CC(=O)NCC |
| InChI | InChI=1S/C11H21N5OS/c1-4-6-13-11-9(14-15-18-11)7-16(3)8-10(17)12-5-2/h13H,4-8H2,1-3H3,(H,12,17) |
| InChIKey | MYEBYEOZHVEVHZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |