C8H15N5OS — CID 62183804
N-methyl-2-[methyl-[[5-(methylamino)thiadiazol-4-yl]methyl]amino]acetamide (PubChem CID 62183804) has the molecular formula C8H15N5OS and a molecular weight of 229.31 g/mol. Its IUPAC name is N-methyl-2-[methyl-[[5-(methylamino)thiadiazol-4-yl]methyl]amino]acetamide.
| Compound Name | N-methyl-2-[methyl-[[5-(methylamino)thiadiazol-4-yl]methyl]amino]acetamide |
|---|---|
| PubChem CID | 62183804 |
| Molecular Formula | C8H15N5OS |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | N-methyl-2-[methyl-[[5-(methylamino)thiadiazol-4-yl]methyl]amino]acetamide |
| SMILES | CNC(=O)CN(C)Cc1nnsc1NC |
| InChI | InChI=1S/C8H15N5OS/c1-9-7(14)5-13(3)4-6-8(10-2)15-12-11-6/h10H,4-5H2,1-3H3,(H,9,14) |
| InChIKey | HVNCROUJYSZTRF-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |