C8H16N6OS — CID 62246445
2-[ethyl-[(5-hydrazinylthiadiazol-4-yl)methyl]amino]-N-methylacetamide (PubChem CID 62246445) has the molecular formula C8H16N6OS and a molecular weight of 244.32 g/mol. Its IUPAC name is 2-[ethyl-[(5-hydrazinylthiadiazol-4-yl)methyl]amino]-N-methylacetamide.
| Compound Name | 2-[ethyl-[(5-hydrazinylthiadiazol-4-yl)methyl]amino]-N-methylacetamide |
|---|---|
| PubChem CID | 62246445 |
| Molecular Formula | C8H16N6OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 2-[ethyl-[(5-hydrazinylthiadiazol-4-yl)methyl]amino]-N-methylacetamide |
| SMILES | CCN(CC(=O)NC)Cc1nnsc1NN |
| InChI | InChI=1S/C8H16N6OS/c1-3-14(5-7(15)10-2)4-6-8(11-9)16-13-12-6/h11H,3-5,9H2,1-2H3,(H,10,15) |
| InChIKey | TVQFAJQLWKXHCZ-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|