C9H19N5OS — CID 62245164
3-[(5-hydrazinylthiadiazol-4-yl)methyl-propan-2-ylamino]propan-1-ol (PubChem CID 62245164) has the molecular formula C9H19N5OS and a molecular weight of 245.35 g/mol. Its IUPAC name is 3-[(5-hydrazinylthiadiazol-4-yl)methyl-propan-2-ylamino]propan-1-ol.
| Compound Name | 3-[(5-hydrazinylthiadiazol-4-yl)methyl-propan-2-ylamino]propan-1-ol |
|---|---|
| PubChem CID | 62245164 |
| Molecular Formula | C9H19N5OS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 3-[(5-hydrazinylthiadiazol-4-yl)methyl-propan-2-ylamino]propan-1-ol |
| SMILES | CC(C)N(CCCO)Cc1nnsc1NN |
| InChI | InChI=1S/C9H19N5OS/c1-7(2)14(4-3-5-15)6-8-9(11-10)16-13-12-8/h7,11,15H,3-6,10H2,1-2H3 |
| InChIKey | DTBJNBVXSLTWDF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|