C12H24N4OS — CID 62207728
2-[[5-(ethylamino)thiadiazol-4-yl]methyl-pentan-3-ylamino]ethanol (PubChem CID 62207728) has the molecular formula C12H24N4OS and a molecular weight of 272.42 g/mol. Its IUPAC name is 2-[[5-(ethylamino)thiadiazol-4-yl]methyl-pentan-3-ylamino]ethanol.
| Compound Name | 2-[[5-(ethylamino)thiadiazol-4-yl]methyl-pentan-3-ylamino]ethanol |
|---|---|
| PubChem CID | 62207728 |
| Molecular Formula | C12H24N4OS |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 2-[[5-(ethylamino)thiadiazol-4-yl]methyl-pentan-3-ylamino]ethanol |
| SMILES | CCNc1snnc1CN(CCO)C(CC)CC |
| InChI | InChI=1S/C12H24N4OS/c1-4-10(5-2)16(7-8-17)9-11-12(13-6-3)18-15-14-11/h10,13,17H,4-9H2,1-3H3 |
| InChIKey | MCFWNWYKMKECKC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |