C11H20N4OS — CID 62208996
2-[cyclopropyl-[[5-(propylamino)thiadiazol-4-yl]methyl]amino]ethanol (PubChem CID 62208996) has the molecular formula C11H20N4OS and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-[cyclopropyl-[[5-(propylamino)thiadiazol-4-yl]methyl]amino]ethanol.
| Compound Name | 2-[cyclopropyl-[[5-(propylamino)thiadiazol-4-yl]methyl]amino]ethanol |
|---|---|
| PubChem CID | 62208996 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-[cyclopropyl-[[5-(propylamino)thiadiazol-4-yl]methyl]amino]ethanol |
| SMILES | CCCNc1snnc1CN(CCO)C1CC1 |
| InChI | InChI=1S/C11H20N4OS/c1-2-5-12-11-10(13-14-17-11)8-15(6-7-16)9-3-4-9/h9,12,16H,2-8H2,1H3 |
| InChIKey | LCCCCTXUXDUZJD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |