C14H20N4OS — CID 62209852
4-[[cyclopropyl(furan-2-ylmethyl)amino]methyl]-N-propylthiadiazol-5-amine (PubChem CID 62209852) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 4-[[cyclopropyl(furan-2-ylmethyl)amino]methyl]-N-propylthiadiazol-5-amine.
| Compound Name | 4-[[cyclopropyl(furan-2-ylmethyl)amino]methyl]-N-propylthiadiazol-5-amine |
|---|---|
| PubChem CID | 62209852 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 4-[[cyclopropyl(furan-2-ylmethyl)amino]methyl]-N-propylthiadiazol-5-amine |
| SMILES | CCCNc1snnc1CN(Cc1ccco1)C1CC1 |
| InChI | InChI=1S/C14H20N4OS/c1-2-7-15-14-13(16-17-20-14)10-18(11-5-6-11)9-12-4-3-8-19-12/h3-4,8,11,15H,2,5-7,9-10H2,1H3 |
| InChIKey | CVFQYVMXTPAIRK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |