C9H18N4OS — CID 62337157
1-[[5-(ethylamino)thiadiazol-4-yl]methyl-methylamino]propan-2-ol (PubChem CID 62337157) has the molecular formula C9H18N4OS and a molecular weight of 230.34 g/mol. Its IUPAC name is 1-[[5-(ethylamino)thiadiazol-4-yl]methyl-methylamino]propan-2-ol.
| Compound Name | 1-[[5-(ethylamino)thiadiazol-4-yl]methyl-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 62337157 |
| Molecular Formula | C9H18N4OS |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-[[5-(ethylamino)thiadiazol-4-yl]methyl-methylamino]propan-2-ol |
| SMILES | CCNc1snnc1CN(C)CC(C)O |
| InChI | InChI=1S/C9H18N4OS/c1-4-10-9-8(11-12-15-9)6-13(3)5-7(2)14/h7,10,14H,4-6H2,1-3H3 |
| InChIKey | PABAGHIVAOHCDT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |