C9H15N5OS — CID 62209102
2-[(5-aminothiadiazol-4-yl)methyl-methylamino]-N-cyclopropylacetamide (PubChem CID 62209102) has the molecular formula C9H15N5OS and a molecular weight of 241.32 g/mol. Its IUPAC name is 2-[(5-aminothiadiazol-4-yl)methyl-methylamino]-N-cyclopropylacetamide.
| Compound Name | 2-[(5-aminothiadiazol-4-yl)methyl-methylamino]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 62209102 |
| Molecular Formula | C9H15N5OS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-[(5-aminothiadiazol-4-yl)methyl-methylamino]-N-cyclopropylacetamide |
| SMILES | CN(CC(=O)NC1CC1)Cc1nnsc1N |
| InChI | InChI=1S/C9H15N5OS/c1-14(4-7-9(10)16-13-12-7)5-8(15)11-6-2-3-6/h6H,2-5,10H2,1H3,(H,11,15) |
| InChIKey | VUWWDFFYPQOOQW-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |