C11H18N6O — CID 86922267
N-cyclopropyl-2-[(1-cyclopropyltetrazol-5-yl)methyl-methylamino]acetamide (PubChem CID 86922267) has the molecular formula C11H18N6O and a molecular weight of 250.31 g/mol. Its IUPAC name is N-cyclopropyl-2-[(1-cyclopropyltetrazol-5-yl)methyl-methylamino]acetamide.
| Compound Name | N-cyclopropyl-2-[(1-cyclopropyltetrazol-5-yl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 86922267 |
| Molecular Formula | C11H18N6O |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | N-cyclopropyl-2-[(1-cyclopropyltetrazol-5-yl)methyl-methylamino]acetamide |
| SMILES | CN(CC(=O)NC1CC1)Cc1nnnn1C1CC1 |
| InChI | InChI=1S/C11H18N6O/c1-16(7-11(18)12-8-2-3-8)6-10-13-14-15-17(10)9-4-5-9/h8-9H,2-7H2,1H3,(H,12,18) |
| InChIKey | DSPXFZXPCUYTMP-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |