C11H17N5OS — CID 94192936
(2R)-N-cyclopropyl-2-[(1-cyclopropyltetrazol-5-yl)methylsulfanyl]propanamide (PubChem CID 94192936) has the molecular formula C11H17N5OS and a molecular weight of 267.36 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-2-[(1-cyclopropyltetrazol-5-yl)methylsulfanyl]propanamide.
| Compound Name | (2R)-N-cyclopropyl-2-[(1-cyclopropyltetrazol-5-yl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 94192936 |
| Molecular Formula | C11H17N5OS |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | (2R)-N-cyclopropyl-2-[(1-cyclopropyltetrazol-5-yl)methylsulfanyl]propanamide |
| SMILES | C[C@@H](SCc1nnnn1C1CC1)C(=O)NC1CC1 |
| InChI | InChI=1S/C11H17N5OS/c1-7(11(17)12-8-2-3-8)18-6-10-13-14-15-16(10)9-4-5-9/h7-9H,2-6H2,1H3,(H,12,17)/t7-/m1/s1 |
| InChIKey | JZQIZPLDDCURKS-SSDOTTSWSA-N |
| XLogP | 0.91 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |