C6H8N4OS — CID 105441111
5-amino-N-cyclopropylthiadiazole-4-carboxamide (PubChem CID 105441111) has the molecular formula C6H8N4OS and a molecular weight of 184.22 g/mol. Its IUPAC name is 5-amino-N-cyclopropylthiadiazole-4-carboxamide.
| Compound Name | 5-amino-N-cyclopropylthiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 105441111 |
| Molecular Formula | C6H8N4OS |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 5-amino-N-cyclopropylthiadiazole-4-carboxamide |
| SMILES | Nc1snnc1C(=O)NC1CC1 |
| InChI | InChI=1S/C6H8N4OS/c7-5-4(9-10-12-5)6(11)8-3-1-2-3/h3H,1-2,7H2,(H,8,11) |
| InChIKey | SISILHQHUWIENC-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |