C11H19Cl2N5O — CID 119474422
3-amino-N-(4-aminocyclohexyl)pyrazine-2-carboxamide;dihydrochloride (PubChem CID 119474422) has the molecular formula C11H19Cl2N5O and a molecular weight of 308.21 g/mol. Its IUPAC name is 3-amino-N-(4-aminocyclohexyl)pyrazine-2-carboxamide;dihydrochloride.
| Compound Name | 3-amino-N-(4-aminocyclohexyl)pyrazine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119474422 |
| Molecular Formula | C11H19Cl2N5O |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 3-amino-N-(4-aminocyclohexyl)pyrazine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1nccnc1C(=O)NC1CCC(N)CC1 |
| InChI | InChI=1S/C11H17N5O.2ClH/c12-7-1-3-8(4-2-7)16-11(17)9-10(13)15-6-5-14-9;;/h5-8H,1-4,12H2,(H2,13,15)(H,16,17);2*1H |
| InChIKey | TTXIBTDJRCABNE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |