C12H19N5O — CID 30768284
3-amino-N-(1-ethylpiperidin-4-yl)pyrazine-2-carboxamide (PubChem CID 30768284) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is 3-amino-N-(1-ethylpiperidin-4-yl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-(1-ethylpiperidin-4-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 30768284 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 3-amino-N-(1-ethylpiperidin-4-yl)pyrazine-2-carboxamide |
| SMILES | CCN1CCC(NC(=O)c2nccnc2N)CC1 |
| InChI | InChI=1S/C12H19N5O/c1-2-17-7-3-9(4-8-17)16-12(18)10-11(13)15-6-5-14-10/h5-6,9H,2-4,7-8H2,1H3,(H2,13,15)(H,16,18) |
| InChIKey | FHWXTXCDIAZVAE-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |