C12H17F3N4O — CID 138033986
N-(1-ethylpiperidin-4-yl)-5-(trifluoromethyl)-1H-imidazole-4-carboxamide (PubChem CID 138033986) has the molecular formula C12H17F3N4O and a molecular weight of 290.29 g/mol. Its IUPAC name is N-(1-ethylpiperidin-4-yl)-5-(trifluoromethyl)-1H-imidazole-4-carboxamide.
| Compound Name | N-(1-ethylpiperidin-4-yl)-5-(trifluoromethyl)-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 138033986 |
| Molecular Formula | C12H17F3N4O |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-(1-ethylpiperidin-4-yl)-5-(trifluoromethyl)-1H-imidazole-4-carboxamide |
| SMILES | CCN1CCC(NC(=O)c2nc[nH]c2C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H17F3N4O/c1-2-19-5-3-8(4-6-19)18-11(20)9-10(12(13,14)15)17-7-16-9/h7-8H,2-6H2,1H3,(H,16,17)(H,18,20) |
| InChIKey | XLBNIIWGUJGYSW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |