C16H18N4O3 — CID 10267750
3-amino-N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]pyrazine-2-carboxamide;formic acid (PubChem CID 10267750) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is 3-amino-N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]pyrazine-2-carboxamide;formic acid.
| Compound Name | 3-amino-N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]pyrazine-2-carboxamide;formic acid |
|---|---|
| PubChem CID | 10267750 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 3-amino-N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]pyrazine-2-carboxamide;formic acid |
| SMILES | Nc1nccnc1C(=O)N[C@H]1CCc2ccccc2C1.O=CO |
| InChI | InChI=1S/C15H16N4O.CH2O2/c16-14-13(17-7-8-18-14)15(20)19-12-6-5-10-3-1-2-4-11(10)9-12;2-1-3/h1-4,7-8,12H,5-6,9H2,(H2,16,18)(H,19,20);1H,(H,2,3)/t12-;/m0./s1 |
| InChIKey | PPPGKOZWVRMPGB-YDALLXLXSA-N |
| XLogP | 1.05 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|