C17H18N2O2 — CID 10493163
5-amino-2-hydroxy-N-(1,2,3,4-tetrahydronaphthalen-2-yl)benzamide (PubChem CID 10493163) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 5-amino-2-hydroxy-N-(1,2,3,4-tetrahydronaphthalen-2-yl)benzamide.
| Compound Name | 5-amino-2-hydroxy-N-(1,2,3,4-tetrahydronaphthalen-2-yl)benzamide |
|---|---|
| PubChem CID | 10493163 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 5-amino-2-hydroxy-N-(1,2,3,4-tetrahydronaphthalen-2-yl)benzamide |
| SMILES | Nc1ccc(O)c(C(=O)NC2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C17H18N2O2/c18-13-6-8-16(20)15(10-13)17(21)19-14-7-5-11-3-1-2-4-12(11)9-14/h1-4,6,8,10,14,20H,5,7,9,18H2,(H,19,21) |
| InChIKey | VBNPSYSJDXIBQH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|