C17H15F2NO — CID 95271360
2,6-difluoro-N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide (PubChem CID 95271360) has the molecular formula C17H15F2NO and a molecular weight of 287.31 g/mol. Its IUPAC name is 2,6-difluoro-N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide.
| Compound Name | 2,6-difluoro-N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide |
|---|---|
| PubChem CID | 95271360 |
| Molecular Formula | C17H15F2NO |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2,6-difluoro-N-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]benzamide |
| SMILES | O=C(N[C@H]1CCc2ccccc2C1)c1c(F)cccc1F |
| InChI | InChI=1S/C17H15F2NO/c18-14-6-3-7-15(19)16(14)17(21)20-13-9-8-11-4-1-2-5-12(11)10-13/h1-7,13H,8-10H2,(H,20,21)/t13-/m0/s1 |
| InChIKey | FLDILBVMQIGIRF-ZDUSSCGKSA-N |
| XLogP | 3.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |