C14H17N7O2 — CID 129476469
3-amino-N-[(3R)-1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]pyrazine-2-carboxamide (PubChem CID 129476469) has the molecular formula C14H17N7O2 and a molecular weight of 315.34 g/mol. Its IUPAC name is 3-amino-N-[(3R)-1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[(3R)-1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 129476469 |
| Molecular Formula | C14H17N7O2 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3-amino-N-[(3R)-1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]pyrazine-2-carboxamide |
| SMILES | Nc1nccnc1C(=O)N[C@@H]1CCCN(c2ncc[nH]c2=O)C1 |
| InChI | InChI=1S/C14H17N7O2/c15-11-10(16-3-4-17-11)13(22)20-9-2-1-7-21(8-9)12-14(23)19-6-5-18-12/h3-6,9H,1-2,7-8H2,(H2,15,17)(H,19,23)(H,20,22)/t9-/m1/s1 |
| InChIKey | QEBPGAWMSSYARI-SECBINFHSA-N |
| XLogP | -0.46 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |