C17H18N6O2 — CID 167764107
N-[1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]-1H-indazole-3-carboxamide (PubChem CID 167764107) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is N-[1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]-1H-indazole-3-carboxamide.
| Compound Name | N-[1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 167764107 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-[1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]-1H-indazole-3-carboxamide |
| SMILES | O=C(NC1CCCN(c2ncc[nH]c2=O)C1)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C17H18N6O2/c24-16(14-12-5-1-2-6-13(12)21-22-14)20-11-4-3-9-23(10-11)15-17(25)19-8-7-18-15/h1-2,5-8,11H,3-4,9-10H2,(H,19,25)(H,20,24)(H,21,22) |
| InChIKey | VAWPEUYROMNYCO-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |