C14H17N5O2S — CID 128967383
1-[1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]-3-thiophen-3-ylurea (PubChem CID 128967383) has the molecular formula C14H17N5O2S and a molecular weight of 319.39 g/mol. Its IUPAC name is 1-[1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]-3-thiophen-3-ylurea.
| Compound Name | 1-[1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]-3-thiophen-3-ylurea |
|---|---|
| PubChem CID | 128967383 |
| Molecular Formula | C14H17N5O2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1-[1-(2-oxo-1H-pyrazin-3-yl)piperidin-3-yl]-3-thiophen-3-ylurea |
| SMILES | O=C(Nc1ccsc1)NC1CCCN(c2ncc[nH]c2=O)C1 |
| InChI | InChI=1S/C14H17N5O2S/c20-13-12(15-4-5-16-13)19-6-1-2-10(8-19)17-14(21)18-11-3-7-22-9-11/h3-5,7,9-10H,1-2,6,8H2,(H,16,20)(H2,17,18,21) |
| InChIKey | TWLHIHUHTKVBPA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |