C18H24N6O2S — CID 126777315
1-[1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-3-yl]-3-thiophen-3-ylurea (PubChem CID 126777315) has the molecular formula C18H24N6O2S and a molecular weight of 388.50 g/mol. Its IUPAC name is 1-[1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-3-yl]-3-thiophen-3-ylurea.
| Compound Name | 1-[1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-3-yl]-3-thiophen-3-ylurea |
|---|---|
| PubChem CID | 126777315 |
| Molecular Formula | C18H24N6O2S |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-[1-(6-morpholin-4-ylpyrimidin-4-yl)piperidin-3-yl]-3-thiophen-3-ylurea |
| SMILES | O=C(Nc1ccsc1)NC1CCCN(c2cc(N3CCOCC3)ncn2)C1 |
| InChI | InChI=1S/C18H24N6O2S/c25-18(22-15-3-9-27-12-15)21-14-2-1-4-24(11-14)17-10-16(19-13-20-17)23-5-7-26-8-6-23/h3,9-10,12-14H,1-2,4-8,11H2,(H2,21,22,25) |
| InChIKey | HXRMSTGQOHAEBT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |