C19H26N6O2 — CID 177305968
[6-[(3R)-3-[(6-morpholin-4-ylpyrimidin-4-yl)amino]piperidin-1-yl]-3-pyridinyl]methanol (PubChem CID 177305968) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is [6-[(3R)-3-[(6-morpholin-4-ylpyrimidin-4-yl)amino]piperidin-1-yl]-3-pyridinyl]methanol.
| Compound Name | [6-[(3R)-3-[(6-morpholin-4-ylpyrimidin-4-yl)amino]piperidin-1-yl]-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 177305968 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | [6-[(3R)-3-[(6-morpholin-4-ylpyrimidin-4-yl)amino]piperidin-1-yl]-3-pyridinyl]methanol |
| SMILES | OCc1ccc(N2CCC[C@@H](Nc3cc(N4CCOCC4)ncn3)C2)nc1 |
| InChI | InChI=1S/C19H26N6O2/c26-13-15-3-4-18(20-11-15)25-5-1-2-16(12-25)23-17-10-19(22-14-21-17)24-6-8-27-9-7-24/h3-4,10-11,14,16,26H,1-2,5-9,12-13H2,(H,21,22,23)/t16-/m1/s1 |
| InChIKey | BSPOQWMQBMHPOO-MRXNPFEDSA-N |
| XLogP | 1.28 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |