C26H36N6O2 — CID 53188800
3-[1-[6-(cyclopropylamino)pyrimidin-4-yl]piperidin-4-yl]-N-[(4-morpholin-4-ylphenyl)methyl]propanamide (PubChem CID 53188800) has the molecular formula C26H36N6O2 and a molecular weight of 464.61 g/mol. Its IUPAC name is 3-[1-[6-(cyclopropylamino)pyrimidin-4-yl]piperidin-4-yl]-N-[(4-morpholin-4-ylphenyl)methyl]propanamide.
| Compound Name | 3-[1-[6-(cyclopropylamino)pyrimidin-4-yl]piperidin-4-yl]-N-[(4-morpholin-4-ylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 53188800 |
| Molecular Formula | C26H36N6O2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | 3-[1-[6-(cyclopropylamino)pyrimidin-4-yl]piperidin-4-yl]-N-[(4-morpholin-4-ylphenyl)methyl]propanamide |
| SMILES | O=C(CCC1CCN(c2cc(NC3CC3)ncn2)CC1)NCc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H36N6O2/c33-26(27-18-21-1-6-23(7-2-21)31-13-15-34-16-14-31)8-3-20-9-11-32(12-10-20)25-17-24(28-19-29-25)30-22-4-5-22/h1-2,6-7,17,19-20,22H,3-5,8-16,18H2,(H,27,33)(H,28,29,30) |
| InChIKey | JYGTZRLRJCJYLE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|